C15H24ClNO — CID 171248247
(R)-oxan-4-yl-(2,4,6-trimethylphenyl)methanamine;hydrochloride (PubChem CID 171248247) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is (R)-oxan-4-yl-(2,4,6-trimethylphenyl)methanamine;hydrochloride.
| Compound Name | (R)-oxan-4-yl-(2,4,6-trimethylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171248247 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (R)-oxan-4-yl-(2,4,6-trimethylphenyl)methanamine;hydrochloride |
| SMILES | Cc1cc(C)c([C@H](N)C2CCOCC2)c(C)c1.Cl |
| InChI | InChI=1S/C15H23NO.ClH/c1-10-8-11(2)14(12(3)9-10)15(16)13-4-6-17-7-5-13;/h8-9,13,15H,4-7,16H2,1-3H3;1H/t15-;/m1./s1 |
| InChIKey | GFRDQXWCPWZKIL-XFULWGLBSA-N |
| XLogP | 3.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |