About 9-ethenylanthracene
9-ethenylanthracene (PubChem CID 17125) has the molecular formula C16H12
and a molecular weight of 204.27 g/mol. Its IUPAC name is 9-ethenylanthracene.
Molecular Properties
| Compound Name | 9-ethenylanthracene |
| PubChem CID | 17125 |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 9-ethenylanthracene |
| SMILES | C=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2 |
| InChIKey | OGOYZCQQQFAGRI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-ethenylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylanthracene?
The IUPAC name of 9-ethenylanthracene (CID 17125) is 9-ethenylanthracene.
What is the SMILES notation for 9-ethenylanthracene?
The canonical SMILES for 9-ethenylanthracene is C=Cc1c2ccccc2cc2ccccc12.
What is the InChIKey of 9-ethenylanthracene?
The InChIKey is OGOYZCQQQFAGRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2.
What are the key properties of 9-ethenylanthracene?
9-ethenylanthracene has a molecular weight of 204.27 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylanthracene is sourced from PubChem (CID 17125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).