C9H7F3N2O — CID 171252704
(4S)-4-(2,3,4-trifluorophenyl)imidazolidin-2-one (PubChem CID 171252704) has the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. Its IUPAC name is (4S)-4-(2,3,4-trifluorophenyl)imidazolidin-2-one.
| Compound Name | (4S)-4-(2,3,4-trifluorophenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 171252704 |
| Molecular Formula | C9H7F3N2O |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (4S)-4-(2,3,4-trifluorophenyl)imidazolidin-2-one |
| SMILES | O=C1NC[C@H](c2ccc(F)c(F)c2F)N1 |
| InChI | InChI=1S/C9H7F3N2O/c10-5-2-1-4(7(11)8(5)12)6-3-13-9(15)14-6/h1-2,6H,3H2,(H2,13,14,15)/t6-/m1/s1 |
| InChIKey | KOKOVKQTXDRHFV-ZCFIWIBFSA-N |
| XLogP | 1.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|