C14H19BrClNO3 — CID 171255082
3-[(S)-amino(cyclohexyl)methyl]-5-bromo-2-hydroxybenzoic acid;hydrochloride (PubChem CID 171255082) has the molecular formula C14H19BrClNO3 and a molecular weight of 364.67 g/mol. Its IUPAC name is 3-[(S)-amino(cyclohexyl)methyl]-5-bromo-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 3-[(S)-amino(cyclohexyl)methyl]-5-bromo-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171255082 |
| Molecular Formula | C14H19BrClNO3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 3-[(S)-amino(cyclohexyl)methyl]-5-bromo-2-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(Br)cc(C(=O)O)c1O)C1CCCCC1 |
| InChI | InChI=1S/C14H18BrNO3.ClH/c15-9-6-10(13(17)11(7-9)14(18)19)12(16)8-4-2-1-3-5-8;/h6-8,12,17H,1-5,16H2,(H,18,19);1H/t12-;/m0./s1 |
| InChIKey | UVDGYYYZEYBXRQ-YDALLXLXSA-N |
| XLogP | 3.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|