C10H9F3N2O — CID 171260551
(3R)-3-amino-3-[2-(trifluoromethoxy)phenyl]propanenitrile (PubChem CID 171260551) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is (3R)-3-amino-3-[2-(trifluoromethoxy)phenyl]propanenitrile.
| Compound Name | (3R)-3-amino-3-[2-(trifluoromethoxy)phenyl]propanenitrile |
|---|---|
| PubChem CID | 171260551 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (3R)-3-amino-3-[2-(trifluoromethoxy)phenyl]propanenitrile |
| SMILES | N#CC[C@@H](N)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)16-9-4-2-1-3-7(9)8(15)5-6-14/h1-4,8H,5,15H2/t8-/m1/s1 |
| InChIKey | UVNODIGDHTUCHC-MRVPVSSYSA-N |
| XLogP | 2.50 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |