C13H20BrNO3 — CID 171265464
(1R,2S)-1-amino-1-(4-bromo-2,5-dimethoxyphenyl)-3-methylbutan-2-ol (PubChem CID 171265464) has the molecular formula C13H20BrNO3 and a molecular weight of 318.21 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-bromo-2,5-dimethoxyphenyl)-3-methylbutan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(4-bromo-2,5-dimethoxyphenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 171265464 |
| Molecular Formula | C13H20BrNO3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-bromo-2,5-dimethoxyphenyl)-3-methylbutan-2-ol |
| SMILES | COc1cc([C@@H](N)[C@@H](O)C(C)C)c(OC)cc1Br |
| InChI | InChI=1S/C13H20BrNO3/c1-7(2)13(16)12(15)8-5-11(18-4)9(14)6-10(8)17-3/h5-7,12-13,16H,15H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | PQUBYEFSMAODNW-OLZOCXBDSA-N |
| XLogP | 2.48 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |