C17H19N3O3S — CID 17126701
N-[(E)-1-[4-(2-amino-2-oxoethoxy)phenyl]ethylideneamino]-5-ethylthiophene-3-carboxamide (PubChem CID 17126701) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[(E)-1-[4-(2-amino-2-oxoethoxy)phenyl]ethylideneamino]-5-ethylthiophene-3-carboxamide.
| Compound Name | N-[(E)-1-[4-(2-amino-2-oxoethoxy)phenyl]ethylideneamino]-5-ethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17126701 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(E)-1-[4-(2-amino-2-oxoethoxy)phenyl]ethylideneamino]-5-ethylthiophene-3-carboxamide |
| SMILES | CCc1cc(C(=O)N/N=C(\C)c2ccc(OCC(N)=O)cc2)cs1 |
| InChI | InChI=1S/C17H19N3O3S/c1-3-15-8-13(10-24-15)17(22)20-19-11(2)12-4-6-14(7-5-12)23-9-16(18)21/h4-8,10H,3,9H2,1-2H3,(H2,18,21)(H,20,22)/b19-11+ |
| InChIKey | JJQDHZSKPNJPPY-YBFXNURJSA-N |
| XLogP | 2.33 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|