C13H19NO3 — CID 171268725
(1S,2R)-1-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentan-2-ol (PubChem CID 171268725) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentan-2-ol |
|---|---|
| PubChem CID | 171268725 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H19NO3/c1-2-3-10(15)13(14)9-4-5-11-12(8-9)17-7-6-16-11/h4-5,8,10,13,15H,2-3,6-7,14H2,1H3/t10-,13+/m1/s1 |
| InChIKey | CMLZAKPTZOQYCJ-MFKMUULPSA-N |
| XLogP | 1.62 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |