C13H20ClNO3 — CID 171270115
methyl 2-[(1S,2R)-1-amino-2-hydroxypentyl]benzoate;hydrochloride (PubChem CID 171270115) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is methyl 2-[(1S,2R)-1-amino-2-hydroxypentyl]benzoate;hydrochloride.
| Compound Name | methyl 2-[(1S,2R)-1-amino-2-hydroxypentyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 171270115 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl 2-[(1S,2R)-1-amino-2-hydroxypentyl]benzoate;hydrochloride |
| SMILES | CCC[C@@H](O)[C@@H](N)c1ccccc1C(=O)OC.Cl |
| InChI | InChI=1S/C13H19NO3.ClH/c1-3-6-11(15)12(14)9-7-4-5-8-10(9)13(16)17-2;/h4-5,7-8,11-12,15H,3,6,14H2,1-2H3;1H/t11-,12+;/m1./s1 |
| InChIKey | ILVILBOYTIUTCR-LYCTWNKOSA-N |
| XLogP | 2.06 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |