C13H20Cl2N2O — CID 171270956
(1R,2S)-2-amino-2-(2-amino-5-chlorophenyl)-1-cyclopentylethanol;hydrochloride (PubChem CID 171270956) has the molecular formula C13H20Cl2N2O and a molecular weight of 291.22 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(2-amino-5-chlorophenyl)-1-cyclopentylethanol;hydrochloride.
| Compound Name | (1R,2S)-2-amino-2-(2-amino-5-chlorophenyl)-1-cyclopentylethanol;hydrochloride |
|---|---|
| PubChem CID | 171270956 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (1R,2S)-2-amino-2-(2-amino-5-chlorophenyl)-1-cyclopentylethanol;hydrochloride |
| SMILES | Cl.Nc1ccc(Cl)cc1[C@H](N)[C@H](O)C1CCCC1 |
| InChI | InChI=1S/C13H19ClN2O.ClH/c14-9-5-6-11(15)10(7-9)12(16)13(17)8-3-1-2-4-8;/h5-8,12-13,17H,1-4,15-16H2;1H/t12-,13+;/m0./s1 |
| InChIKey | OSIDKANRYQQGPX-JHEYCYPBSA-N |
| XLogP | 2.89 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|