C12H22Cl2N2S — CID 171276189
1-[(1S)-1-(3-methylthiophen-2-yl)propyl]piperazine;dihydrochloride (PubChem CID 171276189) has the molecular formula C12H22Cl2N2S and a molecular weight of 297.29 g/mol. Its IUPAC name is 1-[(1S)-1-(3-methylthiophen-2-yl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(3-methylthiophen-2-yl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171276189 |
| Molecular Formula | C12H22Cl2N2S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-[(1S)-1-(3-methylthiophen-2-yl)propyl]piperazine;dihydrochloride |
| SMILES | CC[C@@H](c1sccc1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H20N2S.2ClH/c1-3-11(12-10(2)4-9-15-12)14-7-5-13-6-8-14;;/h4,9,11,13H,3,5-8H2,1-2H3;2*1H/t11-;;/m0../s1 |
| InChIKey | MOPOKCOIINIPFJ-IDMXKUIJSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |