C14H20ClN3 — CID 171276536
1-[(1S)-1-(6-chloro-3-pyridinyl)-2-cyclopropylethyl]piperazine (PubChem CID 171276536) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 1-[(1S)-1-(6-chloro-3-pyridinyl)-2-cyclopropylethyl]piperazine.
| Compound Name | 1-[(1S)-1-(6-chloro-3-pyridinyl)-2-cyclopropylethyl]piperazine |
|---|---|
| PubChem CID | 171276536 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[(1S)-1-(6-chloro-3-pyridinyl)-2-cyclopropylethyl]piperazine |
| SMILES | Clc1ccc([C@H](CC2CC2)N2CCNCC2)cn1 |
| InChI | InChI=1S/C14H20ClN3/c15-14-4-3-12(10-17-14)13(9-11-1-2-11)18-7-5-16-6-8-18/h3-4,10-11,13,16H,1-2,5-9H2/t13-/m0/s1 |
| InChIKey | IQYXSIUYVRSEHB-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|