C12H14Cl2F6N2 — CID 171278008
1-[(1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171278008) has the molecular formula C12H14Cl2F6N2 and a molecular weight of 371.15 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278008 |
| Molecular Formula | C12H14Cl2F6N2 |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cc([C@@H](N2CCNCC2)C(F)(F)F)cc(F)c1F |
| InChI | InChI=1S/C12H12F6N2.2ClH/c13-8-5-7(6-9(14)10(8)15)11(12(16,17)18)20-3-1-19-2-4-20;;/h5-6,11,19H,1-4H2;2*1H/t11-;;/m1../s1 |
| InChIKey | APVQYTIZPXTBNT-NVJADKKVSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|