C15H22BrN3O2 — CID 171278297
1-[(1S)-1-(4-bromo-3-nitrophenyl)-3-methylbutyl]piperazine (PubChem CID 171278297) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromo-3-nitrophenyl)-3-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-(4-bromo-3-nitrophenyl)-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171278297 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-[(1S)-1-(4-bromo-3-nitrophenyl)-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@@H](c1ccc(Br)c([N+](=O)[O-])c1)N1CCNCC1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-11(2)9-14(18-7-5-17-6-8-18)12-3-4-13(16)15(10-12)19(20)21/h3-4,10-11,14,17H,5-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | ICQBODGHVCHHTC-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|