C14H21Cl2FN2O — CID 171285915
3-fluoro-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride (PubChem CID 171285915) has the molecular formula C14H21Cl2FN2O and a molecular weight of 323.24 g/mol. Its IUPAC name is 3-fluoro-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride.
| Compound Name | 3-fluoro-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171285915 |
| Molecular Formula | C14H21Cl2FN2O |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-fluoro-4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
| SMILES | C=CC[C@H](c1ccc(O)cc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H19FN2O.2ClH/c1-2-3-14(17-8-6-16-7-9-17)12-5-4-11(18)10-13(12)15;;/h2,4-5,10,14,16,18H,1,3,6-9H2;2*1H/t14-;;/m1../s1 |
| InChIKey | WTWPGABAGLPAQE-FMOMHUKBSA-N |
| XLogP | 2.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|