C15H22BrCl2FN2 — CID 171288510
1-[(1R)-1-(2-bromo-5-fluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171288510) has the molecular formula C15H22BrCl2FN2 and a molecular weight of 400.16 g/mol. Its IUPAC name is 1-[(1R)-1-(2-bromo-5-fluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-bromo-5-fluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288510 |
| Molecular Formula | C15H22BrCl2FN2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-[(1R)-1-(2-bromo-5-fluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1cc(F)ccc1Br)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H20BrFN2.2ClH/c1-11(2)9-15(19-7-5-18-6-8-19)13-10-12(17)3-4-14(13)16;;/h3-4,10,15,18H,1,5-9H2,2H3;2*1H/t15-;;/m1../s1 |
| InChIKey | JLNBKHRYIWWOOS-QCUBGVIVSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|