C15H23Cl2FN2O — CID 171290555
1-[(1R)-1-(2-fluoro-3-methoxyphenyl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171290555) has the molecular formula C15H23Cl2FN2O and a molecular weight of 337.27 g/mol. Its IUPAC name is 1-[(1R)-1-(2-fluoro-3-methoxyphenyl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-fluoro-3-methoxyphenyl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290555 |
| Molecular Formula | C15H23Cl2FN2O |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-[(1R)-1-(2-fluoro-3-methoxyphenyl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@H](c1cccc(OC)c1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H21FN2O.2ClH/c1-3-5-13(18-10-8-17-9-11-18)12-6-4-7-14(19-2)15(12)16;;/h3-4,6-7,13,17H,1,5,8-11H2,2H3;2*1H/t13-;;/m1../s1 |
| InChIKey | LZZWJCARWUWSDY-FFXKMJQXSA-N |
| XLogP | 3.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|