C17H24BrCl2N3 — CID 171290946
5-bromo-3-[(R)-cyclobutyl(piperazin-1-yl)methyl]-1H-indole;dihydrochloride (PubChem CID 171290946) has the molecular formula C17H24BrCl2N3 and a molecular weight of 421.21 g/mol. Its IUPAC name is 5-bromo-3-[(R)-cyclobutyl(piperazin-1-yl)methyl]-1H-indole;dihydrochloride.
| Compound Name | 5-bromo-3-[(R)-cyclobutyl(piperazin-1-yl)methyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171290946 |
| Molecular Formula | C17H24BrCl2N3 |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 5-bromo-3-[(R)-cyclobutyl(piperazin-1-yl)methyl]-1H-indole;dihydrochloride |
| SMILES | Brc1ccc2[nH]cc([C@@H](C3CCC3)N3CCNCC3)c2c1.Cl.Cl |
| InChI | InChI=1S/C17H22BrN3.2ClH/c18-13-4-5-16-14(10-13)15(11-20-16)17(12-2-1-3-12)21-8-6-19-7-9-21;;/h4-5,10-12,17,19-20H,1-3,6-9H2;2*1H/t17-;;/m1../s1 |
| InChIKey | LTPSLQQTMAOMPY-ZEECNFPPSA-N |
| XLogP | 4.52 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |