C17H24ClN3O2 — CID 171291272
1-[(R)-(2-chloro-5-nitrophenyl)-cyclohexylmethyl]piperazine (PubChem CID 171291272) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-[(R)-(2-chloro-5-nitrophenyl)-cyclohexylmethyl]piperazine.
| Compound Name | 1-[(R)-(2-chloro-5-nitrophenyl)-cyclohexylmethyl]piperazine |
|---|---|
| PubChem CID | 171291272 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[(R)-(2-chloro-5-nitrophenyl)-cyclohexylmethyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(Cl)c([C@@H](C2CCCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H24ClN3O2/c18-16-7-6-14(21(22)23)12-15(16)17(13-4-2-1-3-5-13)20-10-8-19-9-11-20/h6-7,12-13,17,19H,1-5,8-11H2/t17-/m1/s1 |
| InChIKey | NBTOZGHLPWDRHR-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|