C16H19N5O2 — CID 17129797
6-tert-butyl-2-(4,6-dimethylpyrimidin-2-yl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 17129797) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 6-tert-butyl-2-(4,6-dimethylpyrimidin-2-yl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 6-tert-butyl-2-(4,6-dimethylpyrimidin-2-yl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 17129797 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-tert-butyl-2-(4,6-dimethylpyrimidin-2-yl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | Cc1cc(C)nc(-n2[nH]c3[nH]c(C(C)(C)C)cc(=O)c3c2=O)n1 |
| InChI | InChI=1S/C16H19N5O2/c1-8-6-9(2)18-15(17-8)21-14(23)12-10(22)7-11(16(3,4)5)19-13(12)20-21/h6-7H,1-5H3,(H2,19,20,22) |
| InChIKey | GZYVZRYJANRPSD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|