C19H20Cl3NO2 — CID 17129881
2-(2-butan-2-ylphenoxy)-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 17129881) has the molecular formula C19H20Cl3NO2 and a molecular weight of 400.73 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 17129881 |
| Molecular Formula | C19H20Cl3NO2 |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CCC(C)c1ccccc1OC(C)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl3NO2/c1-4-11(2)13-7-5-6-8-18(13)25-12(3)19(24)23-17-10-15(21)14(20)9-16(17)22/h5-12H,4H2,1-3H3,(H,23,24) |
| InChIKey | XVORTHJESOECNO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|