C15H24Cl2FN3O3 — CID 171299307
4-fluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-nitrophenol;dihydrochloride (PubChem CID 171299307) has the molecular formula C15H24Cl2FN3O3 and a molecular weight of 384.28 g/mol. Its IUPAC name is 4-fluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-nitrophenol;dihydrochloride.
| Compound Name | 4-fluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-nitrophenol;dihydrochloride |
|---|---|
| PubChem CID | 171299307 |
| Molecular Formula | C15H24Cl2FN3O3 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-fluoro-2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-nitrophenol;dihydrochloride |
| SMILES | CC(C)C[C@@H](c1cc(F)cc([N+](=O)[O-])c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H22FN3O3.2ClH/c1-10(2)7-13(18-5-3-17-4-6-18)12-8-11(16)9-14(15(12)20)19(21)22;;/h8-10,13,17,20H,3-7H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | XYJPOVLZOCRSFE-GXKRWWSZSA-N |
| XLogP | 3.28 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|