About 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine
1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine (PubChem CID 171302582) has the molecular formula C13H19F3N2S
and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine.
Molecular Properties
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine |
| PubChem CID | 171302582 |
| Molecular Formula | C13H19F3N2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine |
| SMILES | Cc1ccsc1[C@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H19F3N2S/c1-10-3-9-19-12(10)11(2-4-13(14,15)16)18-7-5-17-6-8-18/h3,9,11,17H,2,4-8H2,1H3/t11-/m0/s1 |
| InChIKey | HNAUTSSBQSFDIL-NSHDSACASA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine?
The IUPAC name of 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine (CID 171302582) is 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine.
What is the SMILES notation for 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine?
The canonical SMILES for 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine is Cc1ccsc1[C@H](CCC(F)(F)F)N1CCNCC1.
What is the InChIKey of 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine?
The InChIKey is HNAUTSSBQSFDIL-NSHDSACASA-N. The full InChI is InChI=1S/C13H19F3N2S/c1-10-3-9-19-12(10)11(2-4-13(14,15)16)18-7-5-17-6-8-18/h3,9,11,17H,2,4-8H2,1H3/t11-/m0/s1.
What are the key properties of 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine?
1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine has a molecular weight of 292.37 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butyl]piperazine is sourced from PubChem (CID 171302582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).