C16H25Cl2F3N2O2 — CID 171303391
1-[(1R)-1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride (PubChem CID 171303391) has the molecular formula C16H25Cl2F3N2O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 1-[(1R)-1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303391 |
| Molecular Formula | C16H25Cl2F3N2O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[(1R)-1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride |
| SMILES | COc1ccc(OC)c([C@@H](CCC(F)(F)F)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C16H23F3N2O2.2ClH/c1-22-12-3-4-15(23-2)13(11-12)14(5-6-16(17,18)19)21-9-7-20-8-10-21;;/h3-4,11,14,20H,5-10H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | VNEXYMMKWVFTDC-FMOMHUKBSA-N |
| XLogP | 3.84 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |