C19H23Cl2N3O — CID 171306611
(3R)-3-(3-phenoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306611) has the molecular formula C19H23Cl2N3O and a molecular weight of 380.32 g/mol. Its IUPAC name is (3R)-3-(3-phenoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(3-phenoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306611 |
| Molecular Formula | C19H23Cl2N3O |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (3R)-3-(3-phenoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@H](c1cccc(Oc2ccccc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C19H21N3O.2ClH/c20-10-9-19(22-13-11-21-12-14-22)16-5-4-8-18(15-16)23-17-6-2-1-3-7-17;;/h1-8,15,19,21H,9,11-14H2;2*1H/t19-;;/m1../s1 |
| InChIKey | GEVDYYQIXFHNLK-JQDLGSOUSA-N |
| XLogP | 4.18 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |