C20H28N2O — CID 171307368
1-[(1R)-1-(6-methoxynaphthalen-2-yl)pentyl]piperazine (PubChem CID 171307368) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(1R)-1-(6-methoxynaphthalen-2-yl)pentyl]piperazine.
| Compound Name | 1-[(1R)-1-(6-methoxynaphthalen-2-yl)pentyl]piperazine |
|---|---|
| PubChem CID | 171307368 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(1R)-1-(6-methoxynaphthalen-2-yl)pentyl]piperazine |
| SMILES | CCCC[C@H](c1ccc2cc(OC)ccc2c1)N1CCNCC1 |
| InChI | InChI=1S/C20H28N2O/c1-3-4-5-20(22-12-10-21-11-13-22)18-7-6-17-15-19(23-2)9-8-16(17)14-18/h6-9,14-15,20-21H,3-5,10-13H2,1-2H3/t20-/m1/s1 |
| InChIKey | BQKAINDXWNJSCX-HXUWFJFHSA-N |
| XLogP | 3.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |