C18H28BrCl2N3 — CID 171307876
5-bromo-3-[(1R)-1-piperazin-1-ylhexyl]-1H-indole;dihydrochloride (PubChem CID 171307876) has the molecular formula C18H28BrCl2N3 and a molecular weight of 437.25 g/mol. Its IUPAC name is 5-bromo-3-[(1R)-1-piperazin-1-ylhexyl]-1H-indole;dihydrochloride.
| Compound Name | 5-bromo-3-[(1R)-1-piperazin-1-ylhexyl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 171307876 |
| Molecular Formula | C18H28BrCl2N3 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 5-bromo-3-[(1R)-1-piperazin-1-ylhexyl]-1H-indole;dihydrochloride |
| SMILES | CCCCC[C@H](c1c[nH]c2ccc(Br)cc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H26BrN3.2ClH/c1-2-3-4-5-18(22-10-8-20-9-11-22)16-13-21-17-7-6-14(19)12-15(16)17;;/h6-7,12-13,18,20-21H,2-5,8-11H2,1H3;2*1H/t18-;;/m1../s1 |
| InChIKey | JGTBLFQDGKWJQR-JPKZNVRTSA-N |
| XLogP | 5.30 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|