C17H26Cl2F4N2 — CID 171309262
1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]hexyl]piperazine;dihydrochloride (PubChem CID 171309262) has the molecular formula C17H26Cl2F4N2 and a molecular weight of 405.31 g/mol. Its IUPAC name is 1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171309262 |
| Molecular Formula | C17H26Cl2F4N2 |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@@H](c1c(F)cccc1C(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H24F4N2.2ClH/c1-2-3-4-8-15(23-11-9-22-10-12-23)16-13(17(19,20)21)6-5-7-14(16)18;;/h5-7,15,22H,2-4,8-12H2,1H3;2*1H/t15-;;/m0../s1 |
| InChIKey | QIJYUSXGENQAEB-CKUXDGONSA-N |
| XLogP | 5.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|