C33H34N2O6 — CID 17131186
N,N'-bis[2-(2-phenoxyethoxy)phenyl]pentanediamide (PubChem CID 17131186) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is N,N'-bis[2-(2-phenoxyethoxy)phenyl]pentanediamide.
| Compound Name | N,N'-bis[2-(2-phenoxyethoxy)phenyl]pentanediamide |
|---|---|
| PubChem CID | 17131186 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | N,N'-bis[2-(2-phenoxyethoxy)phenyl]pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccccc1OCCOc1ccccc1)Nc1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C33H34N2O6/c36-32(34-28-16-7-9-18-30(28)40-24-22-38-26-12-3-1-4-13-26)20-11-21-33(37)35-29-17-8-10-19-31(29)41-25-23-39-27-14-5-2-6-15-27/h1-10,12-19H,11,20-25H2,(H,34,36)(H,35,37) |
| InChIKey | GUUVMPGBYXYIIZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|