C11H10F5NO2 — CID 171311860
methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate (PubChem CID 171311860) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate.
| Compound Name | methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate |
|---|---|
| PubChem CID | 171311860 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate |
| SMILES | COC(=O)c1ccccc1[C@H](N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F5NO2/c1-19-9(18)7-5-3-2-4-6(7)8(17)10(12,13)11(14,15)16/h2-5,8H,17H2,1H3/t8-/m0/s1 |
| InChIKey | LZTKHAARMYLVNF-QMMMGPOBSA-N |
| XLogP | 2.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|