methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate

C11H10F5NO2 — CID 171311860

IUPACmethyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate
SMILESCOC(=O)c1ccccc1[C@H](N)C(F)(F)C(F)(F)F
InChIInChI=1S/C11H10F5NO2/c1-19-9(18)7-5-3-2-4-6(7)8(17)10(12,13)11(14,15)16/h2-5,8H,17H2,1H3/t8-/m0/s1
InChIKeyLZTKHAARMYLVNF-QMMMGPOBSA-N
MW283.20 g/mol
LogP2.67
Rot. Bonds3

About methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate

methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate (PubChem CID 171311860) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate.

Molecular Properties

Compound Namemethyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate
PubChem CID171311860
Molecular FormulaC11H10F5NO2
Molecular Weight283.20 g/mol
Exact Mass283.06
IUPAC Namemethyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate
SMILESCOC(=O)c1ccccc1[C@H](N)C(F)(F)C(F)(F)F
InChIInChI=1S/C11H10F5NO2/c1-19-9(18)7-5-3-2-4-6(7)8(17)10(12,13)11(14,15)16/h2-5,8H,17H2,1H3/t8-/m0/s1
InChIKeyLZTKHAARMYLVNF-QMMMGPOBSA-N
XLogP2.67
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.20
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate?
The IUPAC name of methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate (CID 171311860) is methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate.
What is the SMILES notation for methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate?
The canonical SMILES for methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate is COC(=O)c1ccccc1[C@H](N)C(F)(F)C(F)(F)F.
What is the InChIKey of methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate?
The InChIKey is LZTKHAARMYLVNF-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H10F5NO2/c1-19-9(18)7-5-3-2-4-6(7)8(17)10(12,13)11(14,15)16/h2-5,8H,17H2,1H3/t8-/m0/s1.
What are the key properties of methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate?
methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate has a molecular weight of 283.20 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]benzoate is sourced from PubChem (CID 171311860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).