C8H10ClF5N2 — CID 171311904
(1S)-2,2,3,3,3-pentafluoro-1-(1-methylpyrrol-2-yl)propan-1-amine;hydrochloride (PubChem CID 171311904) has the molecular formula C8H10ClF5N2 and a molecular weight of 264.63 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(1-methylpyrrol-2-yl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(1-methylpyrrol-2-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311904 |
| Molecular Formula | C8H10ClF5N2 |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(1-methylpyrrol-2-yl)propan-1-amine;hydrochloride |
| SMILES | Cl.Cn1cccc1[C@H](N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5N2.ClH/c1-15-4-2-3-5(15)6(14)7(9,10)8(11,12)13;/h2-4,6H,14H2,1H3;1H/t6-;/m0./s1 |
| InChIKey | YIANTOARXVESBB-RGMNGODLSA-N |
| XLogP | 2.64 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|