C8H5Cl4F5N2 — CID 171312358
(1R)-2,2,3,3,3-pentafluoro-1-(2,3,5-trichloro-4-pyridinyl)propan-1-amine;hydrochloride (PubChem CID 171312358) has the molecular formula C8H5Cl4F5N2 and a molecular weight of 365.94 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(2,3,5-trichloro-4-pyridinyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(2,3,5-trichloro-4-pyridinyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312358 |
| Molecular Formula | C8H5Cl4F5N2 |
| Molecular Weight | 365.94 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(2,3,5-trichloro-4-pyridinyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1c(Cl)cnc(Cl)c1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4Cl3F5N2.ClH/c9-2-1-18-6(11)4(10)3(2)5(17)7(12,13)8(14,15)16;/h1,5H,17H2;1H/t5-;/m1./s1 |
| InChIKey | WPWNRVZZGMQZJS-NUBCRITNSA-N |
| XLogP | 4.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|