C11H14ClF2NO2 — CID 171313184
[4-[(1S)-1-amino-3,3-difluoropropyl]phenyl] acetate;hydrochloride (PubChem CID 171313184) has the molecular formula C11H14ClF2NO2 and a molecular weight of 265.69 g/mol. Its IUPAC name is [4-[(1S)-1-amino-3,3-difluoropropyl]phenyl] acetate;hydrochloride.
| Compound Name | [4-[(1S)-1-amino-3,3-difluoropropyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171313184 |
| Molecular Formula | C11H14ClF2NO2 |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | [4-[(1S)-1-amino-3,3-difluoropropyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc([C@@H](N)CC(F)F)cc1.Cl |
| InChI | InChI=1S/C11H13F2NO2.ClH/c1-7(15)16-9-4-2-8(3-5-9)10(14)6-11(12)13;/h2-5,10-11H,6,14H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | VIMDPOBWYNGXJK-PPHPATTJSA-N |
| XLogP | 2.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|