C22H20N6O2 — CID 171315156
N-(1-benzyl-1,2,4-triazol-3-yl)-3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 171315156) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171315156 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2)n1)c1cc(C2CC2)nc2onc(C3CC3)c12 |
| InChI | InChI=1S/C22H20N6O2/c29-20(25-22-23-12-28(26-22)11-13-4-2-1-3-5-13)16-10-17(14-6-7-14)24-21-18(16)19(27-30-21)15-8-9-15/h1-5,10,12,14-15H,6-9,11H2,(H,25,26,29) |
| InChIKey | ORTHQEQBWLDSFO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |