C22H21N3O3 — CID 171315249
N-butyl-6-(furan-2-yl)-3-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 171315249) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-butyl-6-(furan-2-yl)-3-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-butyl-6-(furan-2-yl)-3-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171315249 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-butyl-6-(furan-2-yl)-3-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2ccco2)nc2onc(-c3ccc(C)cc3)c12 |
| InChI | InChI=1S/C22H21N3O3/c1-3-4-11-23-21(26)16-13-17(18-6-5-12-27-18)24-22-19(16)20(25-28-22)15-9-7-14(2)8-10-15/h5-10,12-13H,3-4,11H2,1-2H3,(H,23,26) |
| InChIKey | GCJKCZQCJADJSC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|