C9H10BrN3 — CID 171316385
(1S,9R)-5-bromo-2,6,7-triazatricyclo[7.2.1.03,7]dodeca-3,5,10-triene (PubChem CID 171316385) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is (1S,9R)-5-bromo-2,6,7-triazatricyclo[7.2.1.03,7]dodeca-3,5,10-triene.
| Compound Name | (1S,9R)-5-bromo-2,6,7-triazatricyclo[7.2.1.03,7]dodeca-3,5,10-triene |
|---|---|
| PubChem CID | 171316385 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | (1S,9R)-5-bromo-2,6,7-triazatricyclo[7.2.1.03,7]dodeca-3,5,10-triene |
| SMILES | Brc1cc2n(n1)C[C@H]1C=C[C@H](C1)N2 |
| InChI | InChI=1S/C9H10BrN3/c10-8-4-9-11-7-2-1-6(3-7)5-13(9)12-8/h1-2,4,6-7,11H,3,5H2/t6-,7+/m0/s1 |
| InChIKey | DXJDDKYQCGWIDR-NKWVEPMBSA-N |
| XLogP | 2.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|