C28H27Cl3N4O5S — CID 171316402
N-[1-[4-[[2-(4-chlorophenoxy)acetyl]amino]phenyl]ethylideneamino]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 171316402) has the molecular formula C28H27Cl3N4O5S and a molecular weight of 637.97 g/mol. Its IUPAC name is N-[1-[4-[[2-(4-chlorophenoxy)acetyl]amino]phenyl]ethylideneamino]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-[4-[[2-(4-chlorophenoxy)acetyl]amino]phenyl]ethylideneamino]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171316402 |
| Molecular Formula | C28H27Cl3N4O5S |
| Molecular Weight | 637.97 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | N-[1-[4-[[2-(4-chlorophenoxy)acetyl]amino]phenyl]ethylideneamino]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(=NNC(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H27Cl3N4O5S/c1-18(19-2-7-23(8-3-19)32-27(36)17-40-24-9-4-21(29)5-10-24)33-34-28(37)20-12-14-35(15-13-20)41(38,39)26-16-22(30)6-11-25(26)31/h2-11,16,20H,12-15,17H2,1H3,(H,32,36)(H,34,37) |
| InChIKey | WAGPTWBKVAMFST-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|