About 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride
3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride (PubChem CID 171316593) has the molecular formula C14H16ClN3O3
and a molecular weight of 309.75 g/mol. Its IUPAC name is 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride |
| PubChem CID | 171316593 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(c2noc(-c3ccccc3)c2C(=O)O)C1 |
| InChI | InChI=1S/C14H15N3O3.ClH/c15-10-6-7-17(8-10)13-11(14(18)19)12(20-16-13)9-4-2-1-3-5-9;/h1-5,10H,6-8,15H2,(H,18,19);1H/t10-;/m1./s1 |
| InChIKey | DJRCCDDXDXSRHP-HNCPQSOCSA-N |
| XLogP | 2.00 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride?
The IUPAC name of 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride (CID 171316593) is 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride.
What is the SMILES notation for 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride?
The canonical SMILES for 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride is Cl.N[C@@H]1CCN(c2noc(-c3ccccc3)c2C(=O)O)C1.
What is the InChIKey of 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride?
The InChIKey is DJRCCDDXDXSRHP-HNCPQSOCSA-N. The full InChI is InChI=1S/C14H15N3O3.ClH/c15-10-6-7-17(8-10)13-11(14(18)19)12(20-16-13)9-4-2-1-3-5-9;/h1-5,10H,6-8,15H2,(H,18,19);1H/t10-;/m1./s1.
What are the key properties of 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride?
3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride has a molecular weight of 309.75 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-3-aminopyrrolidin-1-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 171316593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).