C21H22N2O3S — CID 171316686
methyl (1S,2R,4R)-7-(3-phenylprop-2-enoyl)-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 171316686) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is methyl (1S,2R,4R)-7-(3-phenylprop-2-enoyl)-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2R,4R)-7-(3-phenylprop-2-enoyl)-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 171316686 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | methyl (1S,2R,4R)-7-(3-phenylprop-2-enoyl)-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2cscn2)C[C@H]2CC[C@@H]1N2C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-26-20(25)21(11-16-13-27-14-22-16)12-17-8-9-18(21)23(17)19(24)10-7-15-5-3-2-4-6-15/h2-7,10,13-14,17-18H,8-9,11-12H2,1H3/t17-,18+,21+/m1/s1 |
| InChIKey | ZLAWYRFGEKYWJV-LQWHRVPQSA-N |
| XLogP | 3.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|