C14H18N2O5S — CID 171316877
formic acid;methyl 5-[[(3aS,6aS)-3-oxo-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]thiophene-2-carboxylate (PubChem CID 171316877) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is formic acid;methyl 5-[[(3aS,6aS)-3-oxo-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]thiophene-2-carboxylate.
| Compound Name | formic acid;methyl 5-[[(3aS,6aS)-3-oxo-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 171316877 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | formic acid;methyl 5-[[(3aS,6aS)-3-oxo-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C[C@@H]3CNC(=O)[C@@H]3C2)s1.O=CO |
| InChI | InChI=1S/C13H16N2O3S.CH2O2/c1-18-13(17)11-3-2-9(19-11)6-15-5-8-4-14-12(16)10(8)7-15;2-1-3/h2-3,8,10H,4-7H2,1H3,(H,14,16);1H,(H,2,3)/t8-,10+;/m0./s1 |
| InChIKey | PEYQHVRGELNPNB-KXNXZCPBSA-N |
| XLogP | 0.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|