C13H23ClN2O2 — CID 171316896
[(4aR,6S,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazin-6-yl]-pyrrolidin-1-ylmethanone;hydrochloride (PubChem CID 171316896) has the molecular formula C13H23ClN2O2 and a molecular weight of 274.79 g/mol. Its IUPAC name is [(4aR,6S,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazin-6-yl]-pyrrolidin-1-ylmethanone;hydrochloride.
| Compound Name | [(4aR,6S,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazin-6-yl]-pyrrolidin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 171316896 |
| Molecular Formula | C13H23ClN2O2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [(4aR,6S,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazin-6-yl]-pyrrolidin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C([C@H]1CC[C@H]2OCCN[C@@H]2C1)N1CCCC1 |
| InChI | InChI=1S/C13H22N2O2.ClH/c16-13(15-6-1-2-7-15)10-3-4-12-11(9-10)14-5-8-17-12;/h10-12,14H,1-9H2;1H/t10-,11+,12+;/m0./s1 |
| InChIKey | INZVJGRECBAAHF-YBWCDFGXSA-N |
| XLogP | 1.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |