C20H31ClN4O3 — CID 171317302
(1R,2S,8S,9S)-11-[2-(4-chloropyrazol-1-yl)ethyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 171317302) has the molecular formula C20H31ClN4O3 and a molecular weight of 410.95 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[2-(4-chloropyrazol-1-yl)ethyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8S,9S)-11-[2-(4-chloropyrazol-1-yl)ethyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 171317302 |
| Molecular Formula | C20H31ClN4O3 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (1R,2S,8S,9S)-11-[2-(4-chloropyrazol-1-yl)ethyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(CCn3cc(Cl)cn3)C2)[C@@H]2CCCC(=O)N21.O=CO |
| InChI | InChI=1S/C19H29ClN4O.CH2O2/c1-2-4-17-14-9-15(18-5-3-6-19(25)24(17)18)12-22(11-14)7-8-23-13-16(20)10-21-23;2-1-3/h10,13-15,17-18H,2-9,11-12H2,1H3;1H,(H,2,3)/t14-,15+,17-,18-;/m0./s1 |
| InChIKey | DHKXKZOVYXQOQX-XUZZAWPESA-N |
| XLogP | 2.74 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|