C19H25N3O6 — CID 171317391
3-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;formic acid (PubChem CID 171317391) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;formic acid.
| Compound Name | 3-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171317391 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 3-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-5-phenyl-1,2-oxazole-4-carboxylic acid;formic acid |
| SMILES | CN(C)CC1COCCN(c2noc(-c3ccccc3)c2C(=O)O)C1.O=CO |
| InChI | InChI=1S/C18H23N3O4.CH2O2/c1-20(2)10-13-11-21(8-9-24-12-13)17-15(18(22)23)16(25-19-17)14-6-4-3-5-7-14;2-1-3/h3-7,13H,8-12H2,1-2H3,(H,22,23);1H,(H,2,3) |
| InChIKey | IEXSIRNPTNBJHL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|