C23H29N3O4 — CID 171317439
formic acid;[4-(3-methoxy-4-pyridinyl)phenyl]-[3-(2-methylpiperidin-1-yl)azetidin-1-yl]methanone (PubChem CID 171317439) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is formic acid;[4-(3-methoxy-4-pyridinyl)phenyl]-[3-(2-methylpiperidin-1-yl)azetidin-1-yl]methanone.
| Compound Name | formic acid;[4-(3-methoxy-4-pyridinyl)phenyl]-[3-(2-methylpiperidin-1-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 171317439 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | formic acid;[4-(3-methoxy-4-pyridinyl)phenyl]-[3-(2-methylpiperidin-1-yl)azetidin-1-yl]methanone |
| SMILES | COc1cnccc1-c1ccc(C(=O)N2CC(N3CCCCC3C)C2)cc1.O=CO |
| InChI | InChI=1S/C22H27N3O2.CH2O2/c1-16-5-3-4-12-25(16)19-14-24(15-19)22(26)18-8-6-17(7-9-18)20-10-11-23-13-21(20)27-2;2-1-3/h6-11,13,16,19H,3-5,12,14-15H2,1-2H3;1H,(H,2,3) |
| InChIKey | IGEORAJZPIYJGB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|