C22H29F12N5O10 — CID 171317704
1-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]pyrrole-2,5-dione;tetrakis(2,2,2-trifluoroacetic acid) (PubChem CID 171317704) has the molecular formula C22H29F12N5O10 and a molecular weight of 751.47 g/mol. Its IUPAC name is 1-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]pyrrole-2,5-dione;tetrakis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]pyrrole-2,5-dione;tetrakis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171317704 |
| Molecular Formula | C22H29F12N5O10 |
| Molecular Weight | 751.47 g/mol |
| Exact Mass | 751.17 |
| IUPAC Name | 1-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]pyrrole-2,5-dione;tetrakis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C1C=CC(=O)N1CCN1CCNCCNCCNCC1 |
| InChI | InChI=1S/C14H25N5O2.4C2HF3O2/c20-13-1-2-14(21)19(13)12-11-18-9-7-16-5-3-15-4-6-17-8-10-18;4*3-2(4,5)1(6)7/h1-2,15-17H,3-12H2;4*(H,6,7) |
| InChIKey | DMKICAGBCKWCPB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 225.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|