About 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide
10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide (PubChem CID 171318573) has the molecular formula C21H24N4O5
and a molecular weight of 412.45 g/mol. Its IUPAC name is 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide.
Molecular Properties
| Compound Name | 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide |
| PubChem CID | 171318573 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide |
| SMILES | O=C(COc1ccccc1)N1CCOC2(C1)CN(C(=O)Nc1cccnc1)CCO2 |
| InChI | InChI=1S/C21H24N4O5/c26-19(14-28-18-6-2-1-3-7-18)24-9-11-29-21(15-24)16-25(10-12-30-21)20(27)23-17-5-4-8-22-13-17/h1-8,13H,9-12,14-16H2,(H,23,27) |
| InChIKey | FFFQEELXOUIYDW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide?
The IUPAC name of 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide (CID 171318573) is 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide.
What is the SMILES notation for 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide?
The canonical SMILES for 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide is O=C(COc1ccccc1)N1CCOC2(C1)CN(C(=O)Nc1cccnc1)CCO2.
What is the InChIKey of 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide?
The InChIKey is FFFQEELXOUIYDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O5/c26-19(14-28-18-6-2-1-3-7-18)24-9-11-29-21(15-24)16-25(10-12-30-21)20(27)23-17-5-4-8-22-13-17/h1-8,13H,9-12,14-16H2,(H,23,27).
What are the key properties of 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide?
10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide has a molecular weight of 412.45 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-phenoxyacetyl)-N-pyridin-3-yl-1,7-dioxa-4,10-diazaspiro[5.5]undecane-4-carboxamide is sourced from PubChem (CID 171318573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).