C13H14FN5O8S2 — CID 171319129
1-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(fluoromethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid (PubChem CID 171319129) has the molecular formula C13H14FN5O8S2 and a molecular weight of 451.41 g/mol. Its IUPAC name is 1-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(fluoromethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid.
| Compound Name | 1-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(fluoromethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 171319129 |
| Molecular Formula | C13H14FN5O8S2 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 1-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3R)-2-(fluoromethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid |
| SMILES | Nc1nc(C(=NOC2(C(=O)O)CC2)C(=O)N[C@H]2C(=O)N(S(=O)(=O)O)[C@@H]2CF)cs1 |
| InChI | InChI=1S/C13H14FN5O8S2/c14-3-6-8(10(21)19(6)29(24,25)26)17-9(20)7(5-4-28-12(15)16-5)18-27-13(1-2-13)11(22)23/h4,6,8H,1-3H2,(H2,15,16)(H,17,20)(H,22,23)(H,24,25,26)/t6-,8-/m1/s1 |
| InChIKey | VOGCYJSPKJJBEE-HTRCEHHLSA-N |
| XLogP | -1.47 |
| TPSA | 201.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|