C23H29N3O3 — CID 171320325
(3aR,4R,6aS)-4-(2,4-dimethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 171320325) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(2,4-dimethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aR,4R,6aS)-4-(2,4-dimethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 171320325 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3aR,4R,6aS)-4-(2,4-dimethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | COc1ncc([C@@]2(O)CC[C@@H]3CN(CC(C)=Cc4ccccc4)C[C@@H]32)c(OC)n1 |
| InChI | InChI=1S/C23H29N3O3/c1-16(11-17-7-5-4-6-8-17)13-26-14-18-9-10-23(27,20(18)15-26)19-12-24-22(29-3)25-21(19)28-2/h4-8,11-12,18,20,27H,9-10,13-15H2,1-3H3/t18-,20+,23+/m1/s1 |
| InChIKey | WUOIHSRQCNJTNU-RFWXGWTQSA-N |
| XLogP | 3.13 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |