C23H27N5O2S — CID 17132129
N-(2,3-dimethylphenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 17132129) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 17132129 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCCc1nnc2n1NC(c1ccc(OC)cc1)C(C(=O)Nc1cccc(C)c1C)S2 |
| InChI | InChI=1S/C23H27N5O2S/c1-5-7-19-25-26-23-28(19)27-20(16-10-12-17(30-4)13-11-16)21(31-23)22(29)24-18-9-6-8-14(2)15(18)3/h6,8-13,20-21,27H,5,7H2,1-4H3,(H,24,29) |
| InChIKey | NVNAGCAFESFTOW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |