C16H17FN2O4 — CID 171321976
6-[(4-fluoro-2-methoxyphenoxy)methyl]-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine;formic acid (PubChem CID 171321976) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 6-[(4-fluoro-2-methoxyphenoxy)methyl]-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine;formic acid.
| Compound Name | 6-[(4-fluoro-2-methoxyphenoxy)methyl]-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine;formic acid |
|---|---|
| PubChem CID | 171321976 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 6-[(4-fluoro-2-methoxyphenoxy)methyl]-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine;formic acid |
| SMILES | COc1cc(F)ccc1OCc1ccc2c(n1)NCC2.O=CO |
| InChI | InChI=1S/C15H15FN2O2.CH2O2/c1-19-14-8-11(16)3-5-13(14)20-9-12-4-2-10-6-7-17-15(10)18-12;2-1-3/h2-5,8H,6-7,9H2,1H3,(H,17,18);1H,(H,2,3) |
| InChIKey | BKAWPPIWISCUAJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|